About CID 87408506
CID 87408506 (PubChem CID 87408506) has the molecular formula C4H8O2Rb
and a molecular weight of 173.57 g/mol.
Molecular Properties
| Compound Name | CID 87408506 |
| PubChem CID | 87408506 |
| Molecular Formula | C4H8O2Rb |
| Molecular Weight | 173.57 g/mol |
| Exact Mass | 172.96 |
| IUPAC Name | — |
| SMILES | CCCC(=O)O.[Rb] |
| InChI | InChI=1S/C4H8O2.Rb/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6); |
| InChIKey | XKWQXHBWELIDTR-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.57 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 87408506 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87408506?
The IUPAC name of CID 87408506 (CID 87408506) is not available.
What is the SMILES notation for CID 87408506?
The canonical SMILES for CID 87408506 is CCCC(=O)O.[Rb].
What is the InChIKey of CID 87408506?
The InChIKey is XKWQXHBWELIDTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.Rb/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);.
What are the key properties of CID 87408506?
CID 87408506 has a molecular weight of 173.57 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87408506 is sourced from PubChem (CID 87408506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).