About CID 87208956
CID 87208956 (PubChem CID 87208956) has the molecular formula C4H8BaO2
and a molecular weight of 225.43 g/mol.
Molecular Properties
| Compound Name | CID 87208956 |
| PubChem CID | 87208956 |
| Molecular Formula | C4H8BaO2 |
| Molecular Weight | 225.43 g/mol |
| Exact Mass | 225.96 |
| IUPAC Name | — |
| SMILES | CCCC(=O)O.[Ba] |
| InChI | InChI=1S/C4H8O2.Ba/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6); |
| InChIKey | NYZWNDUNHWSBLE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 87208956 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87208956?
The IUPAC name of CID 87208956 (CID 87208956) is not available.
What is the SMILES notation for CID 87208956?
The canonical SMILES for CID 87208956 is CCCC(=O)O.[Ba].
What is the InChIKey of CID 87208956?
The InChIKey is NYZWNDUNHWSBLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.Ba/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);.
What are the key properties of CID 87208956?
CID 87208956 has a molecular weight of 225.43 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87208956 is sourced from PubChem (CID 87208956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).