About butanoic acid;praseodymium
butanoic acid;praseodymium (PubChem CID 88777452) has the molecular formula C4H8O2Pr
and a molecular weight of 229.01 g/mol. Its IUPAC name is butanoic acid;praseodymium.
Molecular Properties
| Compound Name | butanoic acid;praseodymium |
| PubChem CID | 88777452 |
| Molecular Formula | C4H8O2Pr |
| Molecular Weight | 229.01 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | butanoic acid;praseodymium |
| SMILES | CCCC(=O)O.[Pr] |
| InChI | InChI=1S/C4H8O2.Pr/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6); |
| InChIKey | JWBHJMABIWLKMF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.01 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butanoic acid;praseodymium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoic acid;praseodymium?
The IUPAC name of butanoic acid;praseodymium (CID 88777452) is butanoic acid;praseodymium.
What is the SMILES notation for butanoic acid;praseodymium?
The canonical SMILES for butanoic acid;praseodymium is CCCC(=O)O.[Pr].
What is the InChIKey of butanoic acid;praseodymium?
The InChIKey is JWBHJMABIWLKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.Pr/c1-2-3-4(5)6;/h2-3H2,1H3,(H,5,6);.
What are the key properties of butanoic acid;praseodymium?
butanoic acid;praseodymium has a molecular weight of 229.01 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butanoic acid;praseodymium is sourced from PubChem (CID 88777452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).