C15H22O5 — CID 164738969
pentadecane-2,3,6,9,12-pentone (PubChem CID 164738969) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is pentadecane-2,3,6,9,12-pentone.
| Compound Name | pentadecane-2,3,6,9,12-pentone |
|---|---|
| PubChem CID | 164738969 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | pentadecane-2,3,6,9,12-pentone |
| SMILES | CCCC(=O)CCC(=O)CCC(=O)CCC(=O)C(C)=O |
| InChI | InChI=1S/C15H22O5/c1-3-4-12(17)5-6-13(18)7-8-14(19)9-10-15(20)11(2)16/h3-10H2,1-2H3 |
| InChIKey | CMOHMCDBIFWHSF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|