About CID 159579687
CID 159579687 (PubChem CID 159579687) has the molecular formula C5H8KO2
and a molecular weight of 139.22 g/mol.
Molecular Properties
| Compound Name | CID 159579687 |
| PubChem CID | 159579687 |
| Molecular Formula | C5H8KO2 |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | — |
| SMILES | CCC(=O)C(C)=O.[K] |
| InChI | InChI=1S/C5H8O2.K/c1-3-5(7)4(2)6;/h3H2,1-2H3; |
| InChIKey | MIVWORLDBCICSB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze CID 159579687 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159579687?
The IUPAC name of CID 159579687 (CID 159579687) is not available.
What is the SMILES notation for CID 159579687?
The canonical SMILES for CID 159579687 is CCC(=O)C(C)=O.[K].
What is the InChIKey of CID 159579687?
The InChIKey is MIVWORLDBCICSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.K/c1-3-5(7)4(2)6;/h3H2,1-2H3;.
What are the key properties of CID 159579687?
CID 159579687 has a molecular weight of 139.22 g/mol, XLogP of 0.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159579687 is sourced from PubChem (CID 159579687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).