About butan-2-one;methanol;hydrate
butan-2-one;methanol;hydrate (PubChem CID 18949731) has the molecular formula C5H14O3
and a molecular weight of 122.16 g/mol. Its IUPAC name is butan-2-one;methanol;hydrate.
Molecular Properties
| Compound Name | butan-2-one;methanol;hydrate |
| PubChem CID | 18949731 |
| Molecular Formula | C5H14O3 |
| Molecular Weight | 122.16 g/mol |
| Exact Mass | 122.09 |
| IUPAC Name | butan-2-one;methanol;hydrate |
| SMILES | CCC(C)=O.CO.O |
| InChI | InChI=1S/C4H8O.CH4O.H2O/c1-3-4(2)5;1-2;/h3H2,1-2H3;2H,1H3;1H2 |
| InChIKey | PQKXUCRKQUTUPW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.16 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;methanol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;methanol;hydrate?
The IUPAC name of butan-2-one;methanol;hydrate (CID 18949731) is butan-2-one;methanol;hydrate.
What is the SMILES notation for butan-2-one;methanol;hydrate?
The canonical SMILES for butan-2-one;methanol;hydrate is CCC(C)=O.CO.O.
What is the InChIKey of butan-2-one;methanol;hydrate?
The InChIKey is PQKXUCRKQUTUPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.CH4O.H2O/c1-3-4(2)5;1-2;/h3H2,1-2H3;2H,1H3;1H2.
What are the key properties of butan-2-one;methanol;hydrate?
butan-2-one;methanol;hydrate has a molecular weight of 122.16 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;methanol;hydrate is sourced from PubChem (CID 18949731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).