About butan-2-one;bis(2,2-dimethylpropane)
butan-2-one;bis(2,2-dimethylpropane) (PubChem CID 162008029) has the molecular formula C14H32O
and a molecular weight of 216.41 g/mol. Its IUPAC name is butan-2-one;bis(2,2-dimethylpropane).
Molecular Properties
| Compound Name | butan-2-one;bis(2,2-dimethylpropane) |
| PubChem CID | 162008029 |
| Molecular Formula | C14H32O |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.25 |
| IUPAC Name | butan-2-one;bis(2,2-dimethylpropane) |
| SMILES | CC(C)(C)C.CC(C)(C)C.CCC(C)=O |
| InChI | InChI=1S/2C5H12.C4H8O/c2*1-5(2,3)4;1-3-4(2)5/h2*1-4H3;3H2,1-2H3 |
| InChIKey | YTCGMBZPSBOHAH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-2-one;bis(2,2-dimethylpropane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;bis(2,2-dimethylpropane)?
The IUPAC name of butan-2-one;bis(2,2-dimethylpropane) (CID 162008029) is butan-2-one;bis(2,2-dimethylpropane).
What is the SMILES notation for butan-2-one;bis(2,2-dimethylpropane)?
The canonical SMILES for butan-2-one;bis(2,2-dimethylpropane) is CC(C)(C)C.CC(C)(C)C.CCC(C)=O.
What is the InChIKey of butan-2-one;bis(2,2-dimethylpropane)?
The InChIKey is YTCGMBZPSBOHAH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H12.C4H8O/c2*1-5(2,3)4;1-3-4(2)5/h2*1-4H3;3H2,1-2H3.
What are the key properties of butan-2-one;bis(2,2-dimethylpropane)?
butan-2-one;bis(2,2-dimethylpropane) has a molecular weight of 216.41 g/mol, XLogP of 5.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;bis(2,2-dimethylpropane) is sourced from PubChem (CID 162008029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).