About butan-2-one;ethane
butan-2-one;ethane (PubChem CID 158905935) has the molecular formula C8H20O
and a molecular weight of 132.25 g/mol. Its IUPAC name is butan-2-one;ethane.
Molecular Properties
| Compound Name | butan-2-one;ethane |
| PubChem CID | 158905935 |
| Molecular Formula | C8H20O |
| Molecular Weight | 132.25 g/mol |
| Exact Mass | 132.15 |
| IUPAC Name | butan-2-one;ethane |
| SMILES | CC.CC.CCC(C)=O |
| InChI | InChI=1S/C4H8O.2C2H6/c1-3-4(2)5;2*1-2/h3H2,1-2H3;2*1-2H3 |
| InChIKey | JGAVBPJFHKZNAS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;ethane?
The IUPAC name of butan-2-one;ethane (CID 158905935) is butan-2-one;ethane.
What is the SMILES notation for butan-2-one;ethane?
The canonical SMILES for butan-2-one;ethane is CC.CC.CCC(C)=O.
What is the InChIKey of butan-2-one;ethane?
The InChIKey is JGAVBPJFHKZNAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.2C2H6/c1-3-4(2)5;2*1-2/h3H2,1-2H3;2*1-2H3.
What are the key properties of butan-2-one;ethane?
butan-2-one;ethane has a molecular weight of 132.25 g/mol, XLogP of 3.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;ethane is sourced from PubChem (CID 158905935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).