About butan-2-one;ethane;propane
butan-2-one;ethane;propane (PubChem CID 169173049) has the molecular formula C12H30O
and a molecular weight of 190.37 g/mol. Its IUPAC name is butan-2-one;ethane;propane.
Molecular Properties
| Compound Name | butan-2-one;ethane;propane |
| PubChem CID | 169173049 |
| Molecular Formula | C12H30O |
| Molecular Weight | 190.37 g/mol |
| Exact Mass | 190.23 |
| IUPAC Name | butan-2-one;ethane;propane |
| SMILES | CC.CCC.CCC.CCC(C)=O |
| InChI | InChI=1S/C4H8O.2C3H8.C2H6/c1-3-4(2)5;2*1-3-2;1-2/h3H2,1-2H3;2*3H2,1-2H3;1-2H3 |
| InChIKey | CBRVDJYSVQAGTE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.37 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-2-one;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;ethane;propane?
The IUPAC name of butan-2-one;ethane;propane (CID 169173049) is butan-2-one;ethane;propane.
What is the SMILES notation for butan-2-one;ethane;propane?
The canonical SMILES for butan-2-one;ethane;propane is CC.CCC.CCC.CCC(C)=O.
What is the InChIKey of butan-2-one;ethane;propane?
The InChIKey is CBRVDJYSVQAGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.2C3H8.C2H6/c1-3-4(2)5;2*1-3-2;1-2/h3H2,1-2H3;2*3H2,1-2H3;1-2H3.
What are the key properties of butan-2-one;ethane;propane?
butan-2-one;ethane;propane has a molecular weight of 190.37 g/mol, XLogP of 4.84, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;ethane;propane is sourced from PubChem (CID 169173049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).