About butan-2-one;methane;propan-2-one
butan-2-one;methane;propan-2-one (PubChem CID 159882043) has the molecular formula C9H22O2
and a molecular weight of 162.27 g/mol. Its IUPAC name is butan-2-one;methane;propan-2-one.
Molecular Properties
| Compound Name | butan-2-one;methane;propan-2-one |
| PubChem CID | 159882043 |
| Molecular Formula | C9H22O2 |
| Molecular Weight | 162.27 g/mol |
| Exact Mass | 162.16 |
| IUPAC Name | butan-2-one;methane;propan-2-one |
| SMILES | C.C.CC(C)=O.CCC(C)=O |
| InChI | InChI=1S/C4H8O.C3H6O.2CH4/c1-3-4(2)5;1-3(2)4;;/h3H2,1-2H3;1-2H3;2*1H4 |
| InChIKey | NTQKYQWOBRPWNT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;methane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;methane;propan-2-one?
The IUPAC name of butan-2-one;methane;propan-2-one (CID 159882043) is butan-2-one;methane;propan-2-one.
What is the SMILES notation for butan-2-one;methane;propan-2-one?
The canonical SMILES for butan-2-one;methane;propan-2-one is C.C.CC(C)=O.CCC(C)=O.
What is the InChIKey of butan-2-one;methane;propan-2-one?
The InChIKey is NTQKYQWOBRPWNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C3H6O.2CH4/c1-3-4(2)5;1-3(2)4;;/h3H2,1-2H3;1-2H3;2*1H4.
What are the key properties of butan-2-one;methane;propan-2-one?
butan-2-one;methane;propan-2-one has a molecular weight of 162.27 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;methane;propan-2-one is sourced from PubChem (CID 159882043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).