About boric acid;butan-2-one
boric acid;butan-2-one (PubChem CID 88852757) has the molecular formula C4H11BO4
and a molecular weight of 133.94 g/mol. Its IUPAC name is boric acid;butan-2-one.
Molecular Properties
| Compound Name | boric acid;butan-2-one |
| PubChem CID | 88852757 |
| Molecular Formula | C4H11BO4 |
| Molecular Weight | 133.94 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | boric acid;butan-2-one |
| SMILES | CCC(C)=O.OB(O)O |
| InChI | InChI=1S/C4H8O.BH3O3/c1-3-4(2)5;2-1(3)4/h3H2,1-2H3;2-4H |
| InChIKey | NEYHGAQGPBEZNQ-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.94 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;butan-2-one?
The IUPAC name of boric acid;butan-2-one (CID 88852757) is boric acid;butan-2-one.
What is the SMILES notation for boric acid;butan-2-one?
The canonical SMILES for boric acid;butan-2-one is CCC(C)=O.OB(O)O.
What is the InChIKey of boric acid;butan-2-one?
The InChIKey is NEYHGAQGPBEZNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.BH3O3/c1-3-4(2)5;2-1(3)4/h3H2,1-2H3;2-4H.
What are the key properties of boric acid;butan-2-one?
boric acid;butan-2-one has a molecular weight of 133.94 g/mol, XLogP of -1.07, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;butan-2-one is sourced from PubChem (CID 88852757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).