About butan-2-one;oxotin
butan-2-one;oxotin (PubChem CID 57474512) has the molecular formula C4H8O2Sn
and a molecular weight of 206.82 g/mol. Its IUPAC name is butan-2-one;oxotin.
Molecular Properties
| Compound Name | butan-2-one;oxotin |
| PubChem CID | 57474512 |
| Molecular Formula | C4H8O2Sn |
| Molecular Weight | 206.82 g/mol |
| Exact Mass | 207.95 |
| IUPAC Name | butan-2-one;oxotin |
| SMILES | CCC(C)=O.O=[Sn] |
| InChI | InChI=1S/C4H8O.O.Sn/c1-3-4(2)5;;/h3H2,1-2H3;; |
| InChIKey | WMPDDEOAFKNSTC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.82 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;oxotin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;oxotin?
The IUPAC name of butan-2-one;oxotin (CID 57474512) is butan-2-one;oxotin.
What is the SMILES notation for butan-2-one;oxotin?
The canonical SMILES for butan-2-one;oxotin is CCC(C)=O.O=[Sn].
What is the InChIKey of butan-2-one;oxotin?
The InChIKey is WMPDDEOAFKNSTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.O.Sn/c1-3-4(2)5;;/h3H2,1-2H3;;.
What are the key properties of butan-2-one;oxotin?
butan-2-one;oxotin has a molecular weight of 206.82 g/mol, XLogP of 0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;oxotin is sourced from PubChem (CID 57474512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).