About butan-2-one;ethane;methanamine
butan-2-one;ethane;methanamine (PubChem CID 172563476) has the molecular formula C9H25NO
and a molecular weight of 163.30 g/mol. Its IUPAC name is butan-2-one;ethane;methanamine.
Molecular Properties
| Compound Name | butan-2-one;ethane;methanamine |
| PubChem CID | 172563476 |
| Molecular Formula | C9H25NO |
| Molecular Weight | 163.30 g/mol |
| Exact Mass | 163.19 |
| IUPAC Name | butan-2-one;ethane;methanamine |
| SMILES | CC.CC.CCC(C)=O.CN |
| InChI | InChI=1S/C4H8O.2C2H6.CH5N/c1-3-4(2)5;3*1-2/h3H2,1-2H3;2*1-2H3;2H2,1H3 |
| InChIKey | DQAHVRGLKJKPRP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;ethane;methanamine?
The IUPAC name of butan-2-one;ethane;methanamine (CID 172563476) is butan-2-one;ethane;methanamine.
What is the SMILES notation for butan-2-one;ethane;methanamine?
The canonical SMILES for butan-2-one;ethane;methanamine is CC.CC.CCC(C)=O.CN.
What is the InChIKey of butan-2-one;ethane;methanamine?
The InChIKey is DQAHVRGLKJKPRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.2C2H6.CH5N/c1-3-4(2)5;3*1-2/h3H2,1-2H3;2*1-2H3;2H2,1H3.
What are the key properties of butan-2-one;ethane;methanamine?
butan-2-one;ethane;methanamine has a molecular weight of 163.30 g/mol, XLogP of 2.61, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;ethane;methanamine is sourced from PubChem (CID 172563476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).