About butan-2-one;N,N-dimethylmethanamine;ethane
butan-2-one;N,N-dimethylmethanamine;ethane (PubChem CID 159619561) has the molecular formula C9H23NO
and a molecular weight of 161.29 g/mol. Its IUPAC name is butan-2-one;N,N-dimethylmethanamine;ethane.
Molecular Properties
| Compound Name | butan-2-one;N,N-dimethylmethanamine;ethane |
| PubChem CID | 159619561 |
| Molecular Formula | C9H23NO |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | butan-2-one;N,N-dimethylmethanamine;ethane |
| SMILES | CC.CCC(C)=O.CN(C)C |
| InChI | InChI=1S/C4H8O.C3H9N.C2H6/c1-3-4(2)5;1-4(2)3;1-2/h3H2,1-2H3;1-3H3;1-2H3 |
| InChIKey | MNSIQZCFHLKSBJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-one;N,N-dimethylmethanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;N,N-dimethylmethanamine;ethane?
The IUPAC name of butan-2-one;N,N-dimethylmethanamine;ethane (CID 159619561) is butan-2-one;N,N-dimethylmethanamine;ethane.
What is the SMILES notation for butan-2-one;N,N-dimethylmethanamine;ethane?
The canonical SMILES for butan-2-one;N,N-dimethylmethanamine;ethane is CC.CCC(C)=O.CN(C)C.
What is the InChIKey of butan-2-one;N,N-dimethylmethanamine;ethane?
The InChIKey is MNSIQZCFHLKSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C3H9N.C2H6/c1-3-4(2)5;1-4(2)3;1-2/h3H2,1-2H3;1-3H3;1-2H3.
What are the key properties of butan-2-one;N,N-dimethylmethanamine;ethane?
butan-2-one;N,N-dimethylmethanamine;ethane has a molecular weight of 161.29 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;N,N-dimethylmethanamine;ethane is sourced from PubChem (CID 159619561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).