About butan-2-one;dichlorocobalt
butan-2-one;dichlorocobalt (PubChem CID 158828987) has the molecular formula C4H8Cl2CoO
and a molecular weight of 201.95 g/mol. Its IUPAC name is butan-2-one;dichlorocobalt.
Molecular Properties
| Compound Name | butan-2-one;dichlorocobalt |
| PubChem CID | 158828987 |
| Molecular Formula | C4H8Cl2CoO |
| Molecular Weight | 201.95 g/mol |
| Exact Mass | 200.93 |
| IUPAC Name | butan-2-one;dichlorocobalt |
| SMILES | CCC(C)=O.Cl[Co]Cl |
| InChI | InChI=1S/C4H8O.2ClH.Co/c1-3-4(2)5;;;/h3H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | IWUPITULOSRSIG-UHFFFAOYSA-L |
| XLogP | 2.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.95 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-2-one;dichlorocobalt with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;dichlorocobalt?
The IUPAC name of butan-2-one;dichlorocobalt (CID 158828987) is butan-2-one;dichlorocobalt.
What is the SMILES notation for butan-2-one;dichlorocobalt?
The canonical SMILES for butan-2-one;dichlorocobalt is CCC(C)=O.Cl[Co]Cl.
What is the InChIKey of butan-2-one;dichlorocobalt?
The InChIKey is IWUPITULOSRSIG-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H8O.2ClH.Co/c1-3-4(2)5;;;/h3H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of butan-2-one;dichlorocobalt?
butan-2-one;dichlorocobalt has a molecular weight of 201.95 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;dichlorocobalt is sourced from PubChem (CID 158828987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).