About butan-2-one;1,1-dichloroethane
butan-2-one;1,1-dichloroethane (PubChem CID 22157903) has the molecular formula C6H12Cl2O
and a molecular weight of 171.07 g/mol. Its IUPAC name is butan-2-one;1,1-dichloroethane.
Molecular Properties
| Compound Name | butan-2-one;1,1-dichloroethane |
| PubChem CID | 22157903 |
| Molecular Formula | C6H12Cl2O |
| Molecular Weight | 171.07 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | butan-2-one;1,1-dichloroethane |
| SMILES | CC(Cl)Cl.CCC(C)=O |
| InChI | InChI=1S/C4H8O.C2H4Cl2/c1-3-4(2)5;1-2(3)4/h3H2,1-2H3;2H,1H3 |
| InChIKey | DNMFYPDTIHNZMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.07 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;1,1-dichloroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;1,1-dichloroethane?
The IUPAC name of butan-2-one;1,1-dichloroethane (CID 22157903) is butan-2-one;1,1-dichloroethane.
What is the SMILES notation for butan-2-one;1,1-dichloroethane?
The canonical SMILES for butan-2-one;1,1-dichloroethane is CC(Cl)Cl.CCC(C)=O.
What is the InChIKey of butan-2-one;1,1-dichloroethane?
The InChIKey is DNMFYPDTIHNZMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C2H4Cl2/c1-3-4(2)5;1-2(3)4/h3H2,1-2H3;2H,1H3.
What are the key properties of butan-2-one;1,1-dichloroethane?
butan-2-one;1,1-dichloroethane has a molecular weight of 171.07 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;1,1-dichloroethane is sourced from PubChem (CID 22157903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).