About propanoate;hydrate
propanoate;hydrate (PubChem CID 19032208) has the molecular formula C3H7O3-
and a molecular weight of 91.09 g/mol. Its IUPAC name is propanoate;hydrate.
Molecular Properties
| Compound Name | propanoate;hydrate |
| PubChem CID | 19032208 |
| Molecular Formula | C3H7O3- |
| Molecular Weight | 91.09 g/mol |
| Exact Mass | 91.04 |
| IUPAC Name | propanoate;hydrate |
| SMILES | CCC(=O)[O-].O |
| InChI | InChI=1S/C3H6O2.H2O/c1-2-3(4)5;/h2H2,1H3,(H,4,5);1H2/p-1 |
| InChIKey | GYPZFDNQZCSGND-UHFFFAOYSA-M |
| XLogP | -1.68 |
| TPSA | 71.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.09 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propanoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoate;hydrate?
The IUPAC name of propanoate;hydrate (CID 19032208) is propanoate;hydrate.
What is the SMILES notation for propanoate;hydrate?
The canonical SMILES for propanoate;hydrate is CCC(=O)[O-].O.
What is the InChIKey of propanoate;hydrate?
The InChIKey is GYPZFDNQZCSGND-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O2.H2O/c1-2-3(4)5;/h2H2,1H3,(H,4,5);1H2/p-1.
What are the key properties of propanoate;hydrate?
propanoate;hydrate has a molecular weight of 91.09 g/mol, XLogP of -1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanoate;hydrate is sourced from PubChem (CID 19032208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).