About indium(1+);propanoate
indium(1+);propanoate (PubChem CID 101213769) has the molecular formula C3H7InO2
and a molecular weight of 189.90 g/mol. Its IUPAC name is indium(1+);propanoate.
Molecular Properties
| Compound Name | indium(1+);propanoate |
| PubChem CID | 101213769 |
| Molecular Formula | C3H7InO2 |
| Molecular Weight | 189.90 g/mol |
| Exact Mass | 189.95 |
| IUPAC Name | indium(1+);propanoate |
| SMILES | CCC(=O)[O-].[InH2+] |
| InChI | InChI=1S/C3H6O2.In.2H/c1-2-3(4)5;;;/h2H2,1H3,(H,4,5);;;/q;+1;;/p-1 |
| InChIKey | UMOBBEULOHOZNE-UHFFFAOYSA-M |
| XLogP | -1.77 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.90 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indium(1+);propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indium(1+);propanoate?
The IUPAC name of indium(1+);propanoate (CID 101213769) is indium(1+);propanoate.
What is the SMILES notation for indium(1+);propanoate?
The canonical SMILES for indium(1+);propanoate is CCC(=O)[O-].[InH2+].
What is the InChIKey of indium(1+);propanoate?
The InChIKey is UMOBBEULOHOZNE-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O2.In.2H/c1-2-3(4)5;;;/h2H2,1H3,(H,4,5);;;/q;+1;;/p-1.
What are the key properties of indium(1+);propanoate?
indium(1+);propanoate has a molecular weight of 189.90 g/mol, XLogP of -1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indium(1+);propanoate is sourced from PubChem (CID 101213769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).