About copper(1+);propanoate
copper(1+);propanoate (PubChem CID 22149607) has the molecular formula C3H5CuO2
and a molecular weight of 136.62 g/mol. Its IUPAC name is copper(1+);propanoate.
Molecular Properties
| Compound Name | copper(1+);propanoate |
| PubChem CID | 22149607 |
| Molecular Formula | C3H5CuO2 |
| Molecular Weight | 136.62 g/mol |
| Exact Mass | 135.96 |
| IUPAC Name | copper(1+);propanoate |
| SMILES | CCC(=O)[O-].[Cu+] |
| InChI | InChI=1S/C3H6O2.Cu/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1 |
| InChIKey | SWMPRGJXLJWZLV-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.62 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper(1+);propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);propanoate?
The IUPAC name of copper(1+);propanoate (CID 22149607) is copper(1+);propanoate.
What is the SMILES notation for copper(1+);propanoate?
The canonical SMILES for copper(1+);propanoate is CCC(=O)[O-].[Cu+].
What is the InChIKey of copper(1+);propanoate?
The InChIKey is SWMPRGJXLJWZLV-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O2.Cu/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1.
What are the key properties of copper(1+);propanoate?
copper(1+);propanoate has a molecular weight of 136.62 g/mol, XLogP of -0.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);propanoate is sourced from PubChem (CID 22149607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).