About propanoate;rubidium(1+)
propanoate;rubidium(1+) (PubChem CID 23716263) has the molecular formula C3H5O2Rb
and a molecular weight of 158.54 g/mol. Its IUPAC name is propanoate;rubidium(1+).
Molecular Properties
| Compound Name | propanoate;rubidium(1+) |
| PubChem CID | 23716263 |
| Molecular Formula | C3H5O2Rb |
| Molecular Weight | 158.54 g/mol |
| Exact Mass | 157.94 |
| IUPAC Name | propanoate;rubidium(1+) |
| SMILES | CCC(=O)[O-].[Rb+] |
| InChI | InChI=1S/C3H6O2.Rb/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1 |
| InChIKey | REGAZBBSEPGAJC-UHFFFAOYSA-M |
| XLogP | -3.85 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.54 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propanoate;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoate;rubidium(1+)?
The IUPAC name of propanoate;rubidium(1+) (CID 23716263) is propanoate;rubidium(1+).
What is the SMILES notation for propanoate;rubidium(1+)?
The canonical SMILES for propanoate;rubidium(1+) is CCC(=O)[O-].[Rb+].
What is the InChIKey of propanoate;rubidium(1+)?
The InChIKey is REGAZBBSEPGAJC-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H6O2.Rb/c1-2-3(4)5;/h2H2,1H3,(H,4,5);/q;+1/p-1.
What are the key properties of propanoate;rubidium(1+)?
propanoate;rubidium(1+) has a molecular weight of 158.54 g/mol, XLogP of -3.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propanoate;rubidium(1+) is sourced from PubChem (CID 23716263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).