About europium(2+);propanoate
europium(2+);propanoate (PubChem CID 88778777) has the molecular formula C6H10EuO4
and a molecular weight of 298.11 g/mol. Its IUPAC name is europium(2+);propanoate.
Molecular Properties
| Compound Name | europium(2+);propanoate |
| PubChem CID | 88778777 |
| Molecular Formula | C6H10EuO4 |
| Molecular Weight | 298.11 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | europium(2+);propanoate |
| SMILES | CCC(=O)[O-].CCC(=O)[O-].[Eu+2] |
| InChI | InChI=1S/2C3H6O2.Eu/c2*1-2-3(4)5;/h2*2H2,1H3,(H,4,5);/q;;+2/p-2 |
| InChIKey | ZDSYVQCGXJLTMS-UHFFFAOYSA-L |
| XLogP | -1.71 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.11 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze europium(2+);propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of europium(2+);propanoate?
The IUPAC name of europium(2+);propanoate (CID 88778777) is europium(2+);propanoate.
What is the SMILES notation for europium(2+);propanoate?
The canonical SMILES for europium(2+);propanoate is CCC(=O)[O-].CCC(=O)[O-].[Eu+2].
What is the InChIKey of europium(2+);propanoate?
The InChIKey is ZDSYVQCGXJLTMS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H6O2.Eu/c2*1-2-3(4)5;/h2*2H2,1H3,(H,4,5);/q;;+2/p-2.
What are the key properties of europium(2+);propanoate?
europium(2+);propanoate has a molecular weight of 298.11 g/mol, XLogP of -1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for europium(2+);propanoate is sourced from PubChem (CID 88778777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).