About antimony(3+);propanoate;diacetate
antimony(3+);propanoate;diacetate (PubChem CID 23464193) has the molecular formula C7H11O6Sb
and a molecular weight of 312.92 g/mol. Its IUPAC name is antimony(3+);propanoate;diacetate.
Molecular Properties
| Compound Name | antimony(3+);propanoate;diacetate |
| PubChem CID | 23464193 |
| Molecular Formula | C7H11O6Sb |
| Molecular Weight | 312.92 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | antimony(3+);propanoate;diacetate |
| SMILES | CC(=O)[O-].CC(=O)[O-].CCC(=O)[O-].[Sb+3] |
| InChI | InChI=1S/C3H6O2.2C2H4O2.Sb/c1-2-3(4)5;2*1-2(3)4;/h2H2,1H3,(H,4,5);2*1H3,(H,3,4);/q;;;+3/p-3 |
| InChIKey | NYXIZOHDIGZZLF-UHFFFAOYSA-K |
| XLogP | -3.72 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.92 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze antimony(3+);propanoate;diacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of antimony(3+);propanoate;diacetate?
The IUPAC name of antimony(3+);propanoate;diacetate (CID 23464193) is antimony(3+);propanoate;diacetate.
What is the SMILES notation for antimony(3+);propanoate;diacetate?
The canonical SMILES for antimony(3+);propanoate;diacetate is CC(=O)[O-].CC(=O)[O-].CCC(=O)[O-].[Sb+3].
What is the InChIKey of antimony(3+);propanoate;diacetate?
The InChIKey is NYXIZOHDIGZZLF-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H6O2.2C2H4O2.Sb/c1-2-3(4)5;2*1-2(3)4;/h2H2,1H3,(H,4,5);2*1H3,(H,3,4);/q;;;+3/p-3.
What are the key properties of antimony(3+);propanoate;diacetate?
antimony(3+);propanoate;diacetate has a molecular weight of 312.92 g/mol, XLogP of -3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for antimony(3+);propanoate;diacetate is sourced from PubChem (CID 23464193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).