About gadolinium;hexane-2,3-dione
gadolinium;hexane-2,3-dione (PubChem CID 87787502) has the molecular formula C6H10GdO2
and a molecular weight of 271.39 g/mol. Its IUPAC name is gadolinium;hexane-2,3-dione.
Molecular Properties
| Compound Name | gadolinium;hexane-2,3-dione |
| PubChem CID | 87787502 |
| Molecular Formula | C6H10GdO2 |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.99 |
| IUPAC Name | gadolinium;hexane-2,3-dione |
| SMILES | CCCC(=O)C(C)=O.[Gd] |
| InChI | InChI=1S/C6H10O2.Gd/c1-3-4-6(8)5(2)7;/h3-4H2,1-2H3; |
| InChIKey | FRVBSZIXZVORQR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze gadolinium;hexane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gadolinium;hexane-2,3-dione?
The IUPAC name of gadolinium;hexane-2,3-dione (CID 87787502) is gadolinium;hexane-2,3-dione.
What is the SMILES notation for gadolinium;hexane-2,3-dione?
The canonical SMILES for gadolinium;hexane-2,3-dione is CCCC(=O)C(C)=O.[Gd].
What is the InChIKey of gadolinium;hexane-2,3-dione?
The InChIKey is FRVBSZIXZVORQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.Gd/c1-3-4-6(8)5(2)7;/h3-4H2,1-2H3;.
What are the key properties of gadolinium;hexane-2,3-dione?
gadolinium;hexane-2,3-dione has a molecular weight of 271.39 g/mol, XLogP of 0.94, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gadolinium;hexane-2,3-dione is sourced from PubChem (CID 87787502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).