About europium;pentane-2,3-dione
europium;pentane-2,3-dione (PubChem CID 162017929) has the molecular formula C5H8EuO2
and a molecular weight of 252.08 g/mol. Its IUPAC name is europium;pentane-2,3-dione.
Molecular Properties
| Compound Name | europium;pentane-2,3-dione |
| PubChem CID | 162017929 |
| Molecular Formula | C5H8EuO2 |
| Molecular Weight | 252.08 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | europium;pentane-2,3-dione |
| SMILES | CCC(=O)C(C)=O.[Eu] |
| InChI | InChI=1S/C5H8O2.Eu/c1-3-5(7)4(2)6;/h3H2,1-2H3; |
| InChIKey | YUJBNTKSQHVHAS-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.08 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze europium;pentane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of europium;pentane-2,3-dione?
The IUPAC name of europium;pentane-2,3-dione (CID 162017929) is europium;pentane-2,3-dione.
What is the SMILES notation for europium;pentane-2,3-dione?
The canonical SMILES for europium;pentane-2,3-dione is CCC(=O)C(C)=O.[Eu].
What is the InChIKey of europium;pentane-2,3-dione?
The InChIKey is YUJBNTKSQHVHAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.Eu/c1-3-5(7)4(2)6;/h3H2,1-2H3;.
What are the key properties of europium;pentane-2,3-dione?
europium;pentane-2,3-dione has a molecular weight of 252.08 g/mol, XLogP of 0.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for europium;pentane-2,3-dione is sourced from PubChem (CID 162017929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).