C9H12O4 — CID 91012231
nonane-2,3,6,8-tetrone (PubChem CID 91012231) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is nonane-2,3,6,8-tetrone.
| Compound Name | nonane-2,3,6,8-tetrone |
|---|---|
| PubChem CID | 91012231 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | nonane-2,3,6,8-tetrone |
| SMILES | CC(=O)CC(=O)CCC(=O)C(C)=O |
| InChI | InChI=1S/C9H12O4/c1-6(10)5-8(12)3-4-9(13)7(2)11/h3-5H2,1-2H3 |
| InChIKey | LZPLLQHTCBPBSX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|