About nonane-2,3,6,8-tetrone
nonane-2,3,6,8-tetrone (PubChem CID 91012231) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is nonane-2,3,6,8-tetrone.
Molecular Properties
| Compound Name | nonane-2,3,6,8-tetrone |
| PubChem CID | 91012231 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | nonane-2,3,6,8-tetrone |
| SMILES | CC(=O)CC(=O)CCC(=O)C(C)=O |
| InChI | InChI=1S/C9H12O4/c1-6(10)5-8(12)3-4-9(13)7(2)11/h3-5H2,1-2H3 |
| InChIKey | LZPLLQHTCBPBSX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze nonane-2,3,6,8-tetrone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonane-2,3,6,8-tetrone?
The IUPAC name of nonane-2,3,6,8-tetrone (CID 91012231) is nonane-2,3,6,8-tetrone.
What is the SMILES notation for nonane-2,3,6,8-tetrone?
The canonical SMILES for nonane-2,3,6,8-tetrone is CC(=O)CC(=O)CCC(=O)C(C)=O.
What is the InChIKey of nonane-2,3,6,8-tetrone?
The InChIKey is LZPLLQHTCBPBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-6(10)5-8(12)3-4-9(13)7(2)11/h3-5H2,1-2H3.
What are the key properties of nonane-2,3,6,8-tetrone?
nonane-2,3,6,8-tetrone has a molecular weight of 184.19 g/mol, XLogP of 0.47, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nonane-2,3,6,8-tetrone is sourced from PubChem (CID 91012231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).