About cobalt(2+);octane-2,4-dione
cobalt(2+);octane-2,4-dione (PubChem CID 22152476) has the molecular formula C8H14CoO2+2
and a molecular weight of 201.13 g/mol. Its IUPAC name is cobalt(2+);octane-2,4-dione.
Molecular Properties
| Compound Name | cobalt(2+);octane-2,4-dione |
| PubChem CID | 22152476 |
| Molecular Formula | C8H14CoO2+2 |
| Molecular Weight | 201.13 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | cobalt(2+);octane-2,4-dione |
| SMILES | CCCCC(=O)CC(C)=O.[Co+2] |
| InChI | InChI=1S/C8H14O2.Co/c1-3-4-5-8(10)6-7(2)9;/h3-6H2,1-2H3;/q;+2 |
| InChIKey | LVLABXDMDOZBHS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.13 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cobalt(2+);octane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(2+);octane-2,4-dione?
The IUPAC name of cobalt(2+);octane-2,4-dione (CID 22152476) is cobalt(2+);octane-2,4-dione.
What is the SMILES notation for cobalt(2+);octane-2,4-dione?
The canonical SMILES for cobalt(2+);octane-2,4-dione is CCCCC(=O)CC(C)=O.[Co+2].
What is the InChIKey of cobalt(2+);octane-2,4-dione?
The InChIKey is LVLABXDMDOZBHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.Co/c1-3-4-5-8(10)6-7(2)9;/h3-6H2,1-2H3;/q;+2.
What are the key properties of cobalt(2+);octane-2,4-dione?
cobalt(2+);octane-2,4-dione has a molecular weight of 201.13 g/mol, XLogP of 1.72, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(2+);octane-2,4-dione is sourced from PubChem (CID 22152476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).