C13H22O3 — CID 154620495
tridecane-2,6,8-trione (PubChem CID 154620495) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is tridecane-2,6,8-trione.
| Compound Name | tridecane-2,6,8-trione |
|---|---|
| PubChem CID | 154620495 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | tridecane-2,6,8-trione |
| SMILES | CCCCCC(=O)CC(=O)CCCC(C)=O |
| InChI | InChI=1S/C13H22O3/c1-3-4-5-8-12(15)10-13(16)9-6-7-11(2)14/h3-10H2,1-2H3 |
| InChIKey | RRBGYNAQMNSKIG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|