About 4-oxoheptanethioyl chloride
4-oxoheptanethioyl chloride (PubChem CID 54463767) has the molecular formula C7H11ClOS
and a molecular weight of 178.68 g/mol. Its IUPAC name is 4-oxoheptanethioyl chloride.
Molecular Properties
| Compound Name | 4-oxoheptanethioyl chloride |
| PubChem CID | 54463767 |
| Molecular Formula | C7H11ClOS |
| Molecular Weight | 178.68 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 4-oxoheptanethioyl chloride |
| SMILES | CCCC(=O)CCC(=S)Cl |
| InChI | InChI=1S/C7H11ClOS/c1-2-3-6(9)4-5-7(8)10/h2-5H2,1H3 |
| InChIKey | XDKWIVIQEAYVCJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.68 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-oxoheptanethioyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxoheptanethioyl chloride?
The IUPAC name of 4-oxoheptanethioyl chloride (CID 54463767) is 4-oxoheptanethioyl chloride.
What is the SMILES notation for 4-oxoheptanethioyl chloride?
The canonical SMILES for 4-oxoheptanethioyl chloride is CCCC(=O)CCC(=S)Cl.
What is the InChIKey of 4-oxoheptanethioyl chloride?
The InChIKey is XDKWIVIQEAYVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClOS/c1-2-3-6(9)4-5-7(8)10/h2-5H2,1H3.
What are the key properties of 4-oxoheptanethioyl chloride?
4-oxoheptanethioyl chloride has a molecular weight of 178.68 g/mol, XLogP of 2.70, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxoheptanethioyl chloride is sourced from PubChem (CID 54463767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).