About nonanethioyl chloride
nonanethioyl chloride (PubChem CID 54550885) has the molecular formula C9H17ClS
and a molecular weight of 192.75 g/mol. Its IUPAC name is nonanethioyl chloride.
Molecular Properties
| Compound Name | nonanethioyl chloride |
| PubChem CID | 54550885 |
| Molecular Formula | C9H17ClS |
| Molecular Weight | 192.75 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | nonanethioyl chloride |
| SMILES | CCCCCCCCC(=S)Cl |
| InChI | InChI=1S/C9H17ClS/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3 |
| InChIKey | ZJVKFDKGUNNYRF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze nonanethioyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonanethioyl chloride?
The IUPAC name of nonanethioyl chloride (CID 54550885) is nonanethioyl chloride.
What is the SMILES notation for nonanethioyl chloride?
The canonical SMILES for nonanethioyl chloride is CCCCCCCCC(=S)Cl.
What is the InChIKey of nonanethioyl chloride?
The InChIKey is ZJVKFDKGUNNYRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClS/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3.
What are the key properties of nonanethioyl chloride?
nonanethioyl chloride has a molecular weight of 192.75 g/mol, XLogP of 4.30, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonanethioyl chloride is sourced from PubChem (CID 54550885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).