About 6-methylidenedodecane
6-methylidenedodecane (PubChem CID 21453027) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is 6-methylidenedodecane.
Molecular Properties
| Compound Name | 6-methylidenedodecane |
| PubChem CID | 21453027 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 6-methylidenedodecane |
| SMILES | C=C(CCCCC)CCCCCC |
| InChI | InChI=1S/C13H26/c1-4-6-8-10-12-13(3)11-9-7-5-2/h3-12H2,1-2H3 |
| InChIKey | CYALHUDNRUHEHS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methylidenedodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylidenedodecane?
The IUPAC name of 6-methylidenedodecane (CID 21453027) is 6-methylidenedodecane.
What is the SMILES notation for 6-methylidenedodecane?
The canonical SMILES for 6-methylidenedodecane is C=C(CCCCC)CCCCCC.
What is the InChIKey of 6-methylidenedodecane?
The InChIKey is CYALHUDNRUHEHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26/c1-4-6-8-10-12-13(3)11-9-7-5-2/h3-12H2,1-2H3.
What are the key properties of 6-methylidenedodecane?
6-methylidenedodecane has a molecular weight of 182.35 g/mol, XLogP of 5.09, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylidenedodecane is sourced from PubChem (CID 21453027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).