About 3-methylidenedecane
3-methylidenedecane (PubChem CID 21453024) has the molecular formula C11H22
and a molecular weight of 154.30 g/mol. Its IUPAC name is 3-methylidenedecane.
Molecular Properties
| Compound Name | 3-methylidenedecane |
| PubChem CID | 21453024 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 3-methylidenedecane |
| SMILES | C=C(CC)CCCCCCC |
| InChI | InChI=1S/C11H22/c1-4-6-7-8-9-10-11(3)5-2/h3-10H2,1-2H3 |
| InChIKey | WDMQRUJFKVKWEJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidenedecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidenedecane?
The IUPAC name of 3-methylidenedecane (CID 21453024) is 3-methylidenedecane.
What is the SMILES notation for 3-methylidenedecane?
The canonical SMILES for 3-methylidenedecane is C=C(CC)CCCCCCC.
What is the InChIKey of 3-methylidenedecane?
The InChIKey is WDMQRUJFKVKWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22/c1-4-6-7-8-9-10-11(3)5-2/h3-10H2,1-2H3.
What are the key properties of 3-methylidenedecane?
3-methylidenedecane has a molecular weight of 154.30 g/mol, XLogP of 4.31, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidenedecane is sourced from PubChem (CID 21453024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).