C26H46 — CID 176610318
3,8,15,20-tetramethylidenedocosane (PubChem CID 176610318) has the molecular formula C26H46 and a molecular weight of 358.65 g/mol. Its IUPAC name is 3,8,15,20-tetramethylidenedocosane.
| Compound Name | 3,8,15,20-tetramethylidenedocosane |
|---|---|
| PubChem CID | 176610318 |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 358.36 |
| IUPAC Name | 3,8,15,20-tetramethylidenedocosane |
| SMILES | C=C(CC)CCCCC(=C)CCCCCCC(=C)CCCCC(=C)CC |
| InChI | InChI=1S/C26H46/c1-7-23(3)17-13-15-21-25(5)19-11-9-10-12-20-26(6)22-16-14-18-24(4)8-2/h3-22H2,1-2H3 |
| InChIKey | ZHSRWCDQUMHECZ-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|