About 3,8-dimethylidenetetradecane;bis(oct-1-ene)
3,8-dimethylidenetetradecane;bis(oct-1-ene) (PubChem CID 173443691) has the molecular formula C32H62
and a molecular weight of 446.85 g/mol. Its IUPAC name is 3,8-dimethylidenetetradecane;bis(oct-1-ene).
Molecular Properties
| Compound Name | 3,8-dimethylidenetetradecane;bis(oct-1-ene) |
| PubChem CID | 173443691 |
| Molecular Formula | C32H62 |
| Molecular Weight | 446.85 g/mol |
| Exact Mass | 446.49 |
| IUPAC Name | 3,8-dimethylidenetetradecane;bis(oct-1-ene) |
| SMILES | C=C(CC)CCCCC(=C)CCCCCC.C=CCCCCCC.C=CCCCCCC |
| InChI | InChI=1S/C16H30.2C8H16/c1-5-7-8-9-13-16(4)14-11-10-12-15(3)6-2;2*1-3-5-7-8-6-4-2/h3-14H2,1-2H3;2*3H,1,4-8H2,2H3 |
| InChIKey | PYPMEBOLYBNUPE-UHFFFAOYSA-N |
| XLogP | 12.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.85 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,8-dimethylidenetetradecane;bis(oct-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-dimethylidenetetradecane;bis(oct-1-ene)?
The IUPAC name of 3,8-dimethylidenetetradecane;bis(oct-1-ene) (CID 173443691) is 3,8-dimethylidenetetradecane;bis(oct-1-ene).
What is the SMILES notation for 3,8-dimethylidenetetradecane;bis(oct-1-ene)?
The canonical SMILES for 3,8-dimethylidenetetradecane;bis(oct-1-ene) is C=C(CC)CCCCC(=C)CCCCCC.C=CCCCCCC.C=CCCCCCC.
What is the InChIKey of 3,8-dimethylidenetetradecane;bis(oct-1-ene)?
The InChIKey is PYPMEBOLYBNUPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30.2C8H16/c1-5-7-8-9-13-16(4)14-11-10-12-15(3)6-2;2*1-3-5-7-8-6-4-2/h3-14H2,1-2H3;2*3H,1,4-8H2,2H3.
What are the key properties of 3,8-dimethylidenetetradecane;bis(oct-1-ene)?
3,8-dimethylidenetetradecane;bis(oct-1-ene) has a molecular weight of 446.85 g/mol, XLogP of 12.33, 21 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-dimethylidenetetradecane;bis(oct-1-ene) is sourced from PubChem (CID 173443691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).