C16H30 — CID 173410299
3,8-dimethylidenetetradecane (PubChem CID 173410299) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 3,8-dimethylidenetetradecane.
| Compound Name | 3,8-dimethylidenetetradecane |
|---|---|
| PubChem CID | 173410299 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 3,8-dimethylidenetetradecane |
| SMILES | C=C(CC)CCCCC(=C)CCCCCC |
| InChI | InChI=1S/C16H30/c1-5-7-8-9-13-16(4)14-11-10-12-15(3)6-2/h3-14H2,1-2H3 |
| InChIKey | CHCWTCUMEHESGL-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|