About 4-methylidenetricosane
4-methylidenetricosane (PubChem CID 139983205) has the molecular formula C24H48
and a molecular weight of 336.65 g/mol. Its IUPAC name is 4-methylidenetricosane.
Molecular Properties
| Compound Name | 4-methylidenetricosane |
| PubChem CID | 139983205 |
| Molecular Formula | C24H48 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.38 |
| IUPAC Name | 4-methylidenetricosane |
| SMILES | C=C(CCC)CCCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C24H48/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(3)22-5-2/h3-23H2,1-2H3 |
| InChIKey | ZIVMTGHTIQAESD-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methylidenetricosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidenetricosane?
The IUPAC name of 4-methylidenetricosane (CID 139983205) is 4-methylidenetricosane.
What is the SMILES notation for 4-methylidenetricosane?
The canonical SMILES for 4-methylidenetricosane is C=C(CCC)CCCCCCCCCCCCCCCCCCC.
What is the InChIKey of 4-methylidenetricosane?
The InChIKey is ZIVMTGHTIQAESD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H48/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(3)22-5-2/h3-23H2,1-2H3.
What are the key properties of 4-methylidenetricosane?
4-methylidenetricosane has a molecular weight of 336.65 g/mol, XLogP of 9.38, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidenetricosane is sourced from PubChem (CID 139983205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).