About 18-methylideneicosanoic acid
18-methylideneicosanoic acid (PubChem CID 154487805) has the molecular formula C21H40O2
and a molecular weight of 324.55 g/mol. Its IUPAC name is 18-methylideneicosanoic acid.
Molecular Properties
| Compound Name | 18-methylideneicosanoic acid |
| PubChem CID | 154487805 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | 18-methylideneicosanoic acid |
| SMILES | C=C(CC)CCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C21H40O2/c1-3-20(2)18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19-21(22)23/h2-19H2,1H3,(H,22,23) |
| InChIKey | YVZBMUPLQKEDDN-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 18-methylideneicosanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 18-methylideneicosanoic acid?
The IUPAC name of 18-methylideneicosanoic acid (CID 154487805) is 18-methylideneicosanoic acid.
What is the SMILES notation for 18-methylideneicosanoic acid?
The canonical SMILES for 18-methylideneicosanoic acid is C=C(CC)CCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 18-methylideneicosanoic acid?
The InChIKey is YVZBMUPLQKEDDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O2/c1-3-20(2)18-16-14-12-10-8-6-4-5-7-9-11-13-15-17-19-21(22)23/h2-19H2,1H3,(H,22,23).
What are the key properties of 18-methylideneicosanoic acid?
18-methylideneicosanoic acid has a molecular weight of 324.55 g/mol, XLogP of 7.28, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 18-methylideneicosanoic acid is sourced from PubChem (CID 154487805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).