About dodecanoic acid;bis(2-methylprop-1-ene)
dodecanoic acid;bis(2-methylprop-1-ene) (PubChem CID 160518474) has the molecular formula C20H40O2
and a molecular weight of 312.54 g/mol. Its IUPAC name is dodecanoic acid;bis(2-methylprop-1-ene).
Molecular Properties
| Compound Name | dodecanoic acid;bis(2-methylprop-1-ene) |
| PubChem CID | 160518474 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | dodecanoic acid;bis(2-methylprop-1-ene) |
| SMILES | C=C(C)C.C=C(C)C.CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C12H24O2.2C4H8/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;2*1-4(2)3/h2-11H2,1H3,(H,13,14);2*1H2,2-3H3 |
| InChIKey | QTYUEEFFNSJNBK-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dodecanoic acid;bis(2-methylprop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecanoic acid;bis(2-methylprop-1-ene)?
The IUPAC name of dodecanoic acid;bis(2-methylprop-1-ene) (CID 160518474) is dodecanoic acid;bis(2-methylprop-1-ene).
What is the SMILES notation for dodecanoic acid;bis(2-methylprop-1-ene)?
The canonical SMILES for dodecanoic acid;bis(2-methylprop-1-ene) is C=C(C)C.C=C(C)C.CCCCCCCCCCCC(=O)O.
What is the InChIKey of dodecanoic acid;bis(2-methylprop-1-ene)?
The InChIKey is QTYUEEFFNSJNBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.2C4H8/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;2*1-4(2)3/h2-11H2,1H3,(H,13,14);2*1H2,2-3H3.
What are the key properties of dodecanoic acid;bis(2-methylprop-1-ene)?
dodecanoic acid;bis(2-methylprop-1-ene) has a molecular weight of 312.54 g/mol, XLogP of 7.16, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodecanoic acid;bis(2-methylprop-1-ene) is sourced from PubChem (CID 160518474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).