About tricosane-12-thione
tricosane-12-thione (PubChem CID 175705265) has the molecular formula C23H46S
and a molecular weight of 354.69 g/mol. Its IUPAC name is tricosane-12-thione.
Molecular Properties
| Compound Name | tricosane-12-thione |
| PubChem CID | 175705265 |
| Molecular Formula | C23H46S |
| Molecular Weight | 354.69 g/mol |
| Exact Mass | 354.33 |
| IUPAC Name | tricosane-12-thione |
| SMILES | CCCCCCCCCCCC(=S)CCCCCCCCCCC |
| InChI | InChI=1S/C23H46S/c1-3-5-7-9-11-13-15-17-19-21-23(24)22-20-18-16-14-12-10-8-6-4-2/h3-22H2,1-2H3 |
| InChIKey | COGUJXHGAALKNZ-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.69 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tricosane-12-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricosane-12-thione?
The IUPAC name of tricosane-12-thione (CID 175705265) is tricosane-12-thione.
What is the SMILES notation for tricosane-12-thione?
The canonical SMILES for tricosane-12-thione is CCCCCCCCCCCC(=S)CCCCCCCCCCC.
What is the InChIKey of tricosane-12-thione?
The InChIKey is COGUJXHGAALKNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46S/c1-3-5-7-9-11-13-15-17-19-21-23(24)22-20-18-16-14-12-10-8-6-4-2/h3-22H2,1-2H3.
What are the key properties of tricosane-12-thione?
tricosane-12-thione has a molecular weight of 354.69 g/mol, XLogP of 9.20, 20 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricosane-12-thione is sourced from PubChem (CID 175705265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).