About tridecane-7-thione
tridecane-7-thione (PubChem CID 13433382) has the molecular formula C13H26S
and a molecular weight of 214.42 g/mol. Its IUPAC name is tridecane-7-thione.
Molecular Properties
| Compound Name | tridecane-7-thione |
| PubChem CID | 13433382 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | tridecane-7-thione |
| SMILES | CCCCCCC(=S)CCCCCC |
| InChI | InChI=1S/C13H26S/c1-3-5-7-9-11-13(14)12-10-8-6-4-2/h3-12H2,1-2H3 |
| InChIKey | CAVWTVGEJGKIDT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze tridecane-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tridecane-7-thione?
The IUPAC name of tridecane-7-thione (CID 13433382) is tridecane-7-thione.
What is the SMILES notation for tridecane-7-thione?
The canonical SMILES for tridecane-7-thione is CCCCCCC(=S)CCCCCC.
What is the InChIKey of tridecane-7-thione?
The InChIKey is CAVWTVGEJGKIDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26S/c1-3-5-7-9-11-13(14)12-10-8-6-4-2/h3-12H2,1-2H3.
What are the key properties of tridecane-7-thione?
tridecane-7-thione has a molecular weight of 214.42 g/mol, XLogP of 5.30, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tridecane-7-thione is sourced from PubChem (CID 13433382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).