About 3-sulfanylidenedecanal
3-sulfanylidenedecanal (PubChem CID 57458817) has the molecular formula C10H18OS
and a molecular weight of 186.32 g/mol. Its IUPAC name is 3-sulfanylidenedecanal.
Molecular Properties
| Compound Name | 3-sulfanylidenedecanal |
| PubChem CID | 57458817 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 3-sulfanylidenedecanal |
| SMILES | CCCCCCCC(=S)CC=O |
| InChI | InChI=1S/C10H18OS/c1-2-3-4-5-6-7-10(12)8-9-11/h9H,2-8H2,1H3 |
| InChIKey | IDDFXTIPTDPJNL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylidenedecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylidenedecanal?
The IUPAC name of 3-sulfanylidenedecanal (CID 57458817) is 3-sulfanylidenedecanal.
What is the SMILES notation for 3-sulfanylidenedecanal?
The canonical SMILES for 3-sulfanylidenedecanal is CCCCCCCC(=S)CC=O.
What is the InChIKey of 3-sulfanylidenedecanal?
The InChIKey is IDDFXTIPTDPJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OS/c1-2-3-4-5-6-7-10(12)8-9-11/h9H,2-8H2,1H3.
What are the key properties of 3-sulfanylidenedecanal?
3-sulfanylidenedecanal has a molecular weight of 186.32 g/mol, XLogP of 3.31, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylidenedecanal is sourced from PubChem (CID 57458817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).