About formic acid;henicosane-7,12-dione
formic acid;henicosane-7,12-dione (PubChem CID 175044766) has the molecular formula C22H42O4
and a molecular weight of 370.57 g/mol. Its IUPAC name is formic acid;henicosane-7,12-dione.
Molecular Properties
| Compound Name | formic acid;henicosane-7,12-dione |
| PubChem CID | 175044766 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | formic acid;henicosane-7,12-dione |
| SMILES | CCCCCCCCCC(=O)CCCCC(=O)CCCCCC.O=CO |
| InChI | InChI=1S/C21H40O2.CH2O2/c1-3-5-7-9-10-11-13-17-21(23)19-15-14-18-20(22)16-12-8-6-4-2;2-1-3/h3-19H2,1-2H3;1H,(H,2,3) |
| InChIKey | RCNDGXWWKVMZAA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formic acid;henicosane-7,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;henicosane-7,12-dione?
The IUPAC name of formic acid;henicosane-7,12-dione (CID 175044766) is formic acid;henicosane-7,12-dione.
What is the SMILES notation for formic acid;henicosane-7,12-dione?
The canonical SMILES for formic acid;henicosane-7,12-dione is CCCCCCCCCC(=O)CCCCC(=O)CCCCCC.O=CO.
What is the InChIKey of formic acid;henicosane-7,12-dione?
The InChIKey is RCNDGXWWKVMZAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O2.CH2O2/c1-3-5-7-9-10-11-13-17-21(23)19-15-14-18-20(22)16-12-8-6-4-2;2-1-3/h3-19H2,1-2H3;1H,(H,2,3).
What are the key properties of formic acid;henicosane-7,12-dione?
formic acid;henicosane-7,12-dione has a molecular weight of 370.57 g/mol, XLogP of 6.50, 18 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;henicosane-7,12-dione is sourced from PubChem (CID 175044766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).