About disodium;3-oxohexadecanal;sulfite
disodium;3-oxohexadecanal;sulfite (PubChem CID 174494045) has the molecular formula C16H30Na2O5S
and a molecular weight of 380.46 g/mol. Its IUPAC name is disodium;3-oxohexadecanal;sulfite.
Molecular Properties
| Compound Name | disodium;3-oxohexadecanal;sulfite |
| PubChem CID | 174494045 |
| Molecular Formula | C16H30Na2O5S |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | disodium;3-oxohexadecanal;sulfite |
| SMILES | CCCCCCCCCCCCCC(=O)CC=O.O=S([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C16H30O2.2Na.H2O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(18)14-15-17;;;1-4(2)3/h15H,2-14H2,1H3;;;(H2,1,2,3)/q;2*+1;/p-2 |
| InChIKey | UXVDASOGKZCQMV-UHFFFAOYSA-L |
| XLogP | -2.15 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze disodium;3-oxohexadecanal;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;3-oxohexadecanal;sulfite?
The IUPAC name of disodium;3-oxohexadecanal;sulfite (CID 174494045) is disodium;3-oxohexadecanal;sulfite.
What is the SMILES notation for disodium;3-oxohexadecanal;sulfite?
The canonical SMILES for disodium;3-oxohexadecanal;sulfite is CCCCCCCCCCCCCC(=O)CC=O.O=S([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;3-oxohexadecanal;sulfite?
The InChIKey is UXVDASOGKZCQMV-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H30O2.2Na.H2O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16(18)14-15-17;;;1-4(2)3/h15H,2-14H2,1H3;;;(H2,1,2,3)/q;2*+1;/p-2.
What are the key properties of disodium;3-oxohexadecanal;sulfite?
disodium;3-oxohexadecanal;sulfite has a molecular weight of 380.46 g/mol, XLogP of -2.15, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;3-oxohexadecanal;sulfite is sourced from PubChem (CID 174494045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).