About 2-sulfanylidenenonanal
2-sulfanylidenenonanal (PubChem CID 173275971) has the molecular formula C9H16OS
and a molecular weight of 172.29 g/mol. Its IUPAC name is 2-sulfanylidenenonanal.
Molecular Properties
| Compound Name | 2-sulfanylidenenonanal |
| PubChem CID | 173275971 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 2-sulfanylidenenonanal |
| SMILES | CCCCCCCC(=S)C=O |
| InChI | InChI=1S/C9H16OS/c1-2-3-4-5-6-7-9(11)8-10/h8H,2-7H2,1H3 |
| InChIKey | WRDNGDVEFHPNEJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidenenonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidenenonanal?
The IUPAC name of 2-sulfanylidenenonanal (CID 173275971) is 2-sulfanylidenenonanal.
What is the SMILES notation for 2-sulfanylidenenonanal?
The canonical SMILES for 2-sulfanylidenenonanal is CCCCCCCC(=S)C=O.
What is the InChIKey of 2-sulfanylidenenonanal?
The InChIKey is WRDNGDVEFHPNEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS/c1-2-3-4-5-6-7-9(11)8-10/h8H,2-7H2,1H3.
What are the key properties of 2-sulfanylidenenonanal?
2-sulfanylidenenonanal has a molecular weight of 172.29 g/mol, XLogP of 2.92, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidenenonanal is sourced from PubChem (CID 173275971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).