About 2-pentylideneoctanal
2-pentylideneoctanal (PubChem CID 57053473) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is 2-pentylideneoctanal.
Molecular Properties
| Compound Name | 2-pentylideneoctanal |
| PubChem CID | 57053473 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 2-pentylideneoctanal |
| SMILES | CCCCC=C(C=O)CCCCCC |
| InChI | InChI=1S/C13H24O/c1-3-5-7-9-11-13(12-14)10-8-6-4-2/h10,12H,3-9,11H2,1-2H3 |
| InChIKey | WUMHTWJKXZSQHI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-pentylideneoctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pentylideneoctanal?
The IUPAC name of 2-pentylideneoctanal (CID 57053473) is 2-pentylideneoctanal.
What is the SMILES notation for 2-pentylideneoctanal?
The canonical SMILES for 2-pentylideneoctanal is CCCCC=C(C=O)CCCCCC.
What is the InChIKey of 2-pentylideneoctanal?
The InChIKey is WUMHTWJKXZSQHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O/c1-3-5-7-9-11-13(12-14)10-8-6-4-2/h10,12H,3-9,11H2,1-2H3.
What are the key properties of 2-pentylideneoctanal?
2-pentylideneoctanal has a molecular weight of 196.33 g/mol, XLogP of 4.27, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pentylideneoctanal is sourced from PubChem (CID 57053473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).