About 2-octylundec-2-enal;pent-2-enal
2-octylundec-2-enal;pent-2-enal (PubChem CID 173412811) has the molecular formula C24H44O2
and a molecular weight of 364.61 g/mol. Its IUPAC name is 2-octylundec-2-enal;pent-2-enal.
Molecular Properties
| Compound Name | 2-octylundec-2-enal;pent-2-enal |
| PubChem CID | 173412811 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | 2-octylundec-2-enal;pent-2-enal |
| SMILES | CCC=CC=O.CCCCCCCCC=C(C=O)CCCCCCCC |
| InChI | InChI=1S/C19H36O.C5H8O/c1-3-5-7-9-11-13-15-17-19(18-20)16-14-12-10-8-6-4-2;1-2-3-4-5-6/h17-18H,3-16H2,1-2H3;3-5H,2H2,1H3 |
| InChIKey | PUQXEXBHDLRZPX-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-octylundec-2-enal;pent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylundec-2-enal;pent-2-enal?
The IUPAC name of 2-octylundec-2-enal;pent-2-enal (CID 173412811) is 2-octylundec-2-enal;pent-2-enal.
What is the SMILES notation for 2-octylundec-2-enal;pent-2-enal?
The canonical SMILES for 2-octylundec-2-enal;pent-2-enal is CCC=CC=O.CCCCCCCCC=C(C=O)CCCCCCCC.
What is the InChIKey of 2-octylundec-2-enal;pent-2-enal?
The InChIKey is PUQXEXBHDLRZPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O.C5H8O/c1-3-5-7-9-11-13-15-17-19(18-20)16-14-12-10-8-6-4-2;1-2-3-4-5-6/h17-18H,3-16H2,1-2H3;3-5H,2H2,1H3.
What are the key properties of 2-octylundec-2-enal;pent-2-enal?
2-octylundec-2-enal;pent-2-enal has a molecular weight of 364.61 g/mol, XLogP of 7.76, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylundec-2-enal;pent-2-enal is sourced from PubChem (CID 173412811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).