About 2-iminohexadecanal
2-iminohexadecanal (PubChem CID 142761147) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-iminohexadecanal.
Molecular Properties
| Compound Name | 2-iminohexadecanal |
| PubChem CID | 142761147 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | 2-iminohexadecanal |
| SMILES | [H]/N=C(\C=O)CCCCCCCCCCCCCC |
| InChI | InChI=1S/C16H31NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(17)15-18/h15,17H,2-14H2,1H3/b17-16- |
| InChIKey | BHWGIHNLFFBNQM-MSUUIHNZSA-N |
| XLogP | 5.30 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminohexadecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminohexadecanal?
The IUPAC name of 2-iminohexadecanal (CID 142761147) is 2-iminohexadecanal.
What is the SMILES notation for 2-iminohexadecanal?
The canonical SMILES for 2-iminohexadecanal is [H]/N=C(\C=O)CCCCCCCCCCCCCC.
What is the InChIKey of 2-iminohexadecanal?
The InChIKey is BHWGIHNLFFBNQM-MSUUIHNZSA-N. The full InChI is InChI=1S/C16H31NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16(17)15-18/h15,17H,2-14H2,1H3/b17-16-.
What are the key properties of 2-iminohexadecanal?
2-iminohexadecanal has a molecular weight of 253.43 g/mol, XLogP of 5.30, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminohexadecanal is sourced from PubChem (CID 142761147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).