About CID 11105912
CID 11105912 (PubChem CID 11105912) has the molecular formula C6H12NSe
and a molecular weight of 177.13 g/mol.
Molecular Properties
| Compound Name | CID 11105912 |
| PubChem CID | 11105912 |
| Molecular Formula | C6H12NSe |
| Molecular Weight | 177.13 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\[Se])CCCCC |
| InChI | InChI=1S/C6H12NSe/c1-2-3-4-5-6(7)8/h7H,2-5H2,1H3/b7-6- |
| InChIKey | FIHSMEDRLSZESD-SREVYHEPSA-N |
| XLogP | 1.71 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.13 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 11105912 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11105912?
The IUPAC name of CID 11105912 (CID 11105912) is not available.
What is the SMILES notation for CID 11105912?
The canonical SMILES for CID 11105912 is [H]/N=C(\[Se])CCCCC.
What is the InChIKey of CID 11105912?
The InChIKey is FIHSMEDRLSZESD-SREVYHEPSA-N. The full InChI is InChI=1S/C6H12NSe/c1-2-3-4-5-6(7)8/h7H,2-5H2,1H3/b7-6-.
What are the key properties of CID 11105912?
CID 11105912 has a molecular weight of 177.13 g/mol, XLogP of 1.71, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11105912 is sourced from PubChem (CID 11105912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).