About 3-iminododecan-1-ol
3-iminododecan-1-ol (PubChem CID 57239624) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 3-iminododecan-1-ol.
Molecular Properties
| Compound Name | 3-iminododecan-1-ol |
| PubChem CID | 57239624 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 3-iminododecan-1-ol |
| SMILES | [H]/N=C(\CCO)CCCCCCCCC |
| InChI | InChI=1S/C12H25NO/c1-2-3-4-5-6-7-8-9-12(13)10-11-14/h13-14H,2-11H2,1H3/b13-12- |
| InChIKey | WTGOJLZERNJKNJ-SEYXRHQNSA-N |
| XLogP | 3.53 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminododecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminododecan-1-ol?
The IUPAC name of 3-iminododecan-1-ol (CID 57239624) is 3-iminododecan-1-ol.
What is the SMILES notation for 3-iminododecan-1-ol?
The canonical SMILES for 3-iminododecan-1-ol is [H]/N=C(\CCO)CCCCCCCCC.
What is the InChIKey of 3-iminododecan-1-ol?
The InChIKey is WTGOJLZERNJKNJ-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H25NO/c1-2-3-4-5-6-7-8-9-12(13)10-11-14/h13-14H,2-11H2,1H3/b13-12-.
What are the key properties of 3-iminododecan-1-ol?
3-iminododecan-1-ol has a molecular weight of 199.34 g/mol, XLogP of 3.53, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminododecan-1-ol is sourced from PubChem (CID 57239624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).