About heptanimidoyl cyanide
heptanimidoyl cyanide (PubChem CID 155128085) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is heptanimidoyl cyanide.
Molecular Properties
| Compound Name | heptanimidoyl cyanide |
| PubChem CID | 155128085 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | heptanimidoyl cyanide |
| SMILES | [H]/N=C(\C#N)CCCCCC |
| InChI | InChI=1S/C8H14N2/c1-2-3-4-5-6-8(10)7-9/h10H,2-6H2,1H3/b10-8- |
| InChIKey | YZFLLVWDXRXYFN-NTMALXAHSA-N |
| XLogP | 2.50 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze heptanimidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptanimidoyl cyanide?
The IUPAC name of heptanimidoyl cyanide (CID 155128085) is heptanimidoyl cyanide.
What is the SMILES notation for heptanimidoyl cyanide?
The canonical SMILES for heptanimidoyl cyanide is [H]/N=C(\C#N)CCCCCC.
What is the InChIKey of heptanimidoyl cyanide?
The InChIKey is YZFLLVWDXRXYFN-NTMALXAHSA-N. The full InChI is InChI=1S/C8H14N2/c1-2-3-4-5-6-8(10)7-9/h10H,2-6H2,1H3/b10-8-.
What are the key properties of heptanimidoyl cyanide?
heptanimidoyl cyanide has a molecular weight of 138.21 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptanimidoyl cyanide is sourced from PubChem (CID 155128085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).