About henicosanoyl cyanide
henicosanoyl cyanide (PubChem CID 54273514) has the molecular formula C22H41NO
and a molecular weight of 335.58 g/mol. Its IUPAC name is henicosanoyl cyanide.
Molecular Properties
| Compound Name | henicosanoyl cyanide |
| PubChem CID | 54273514 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | henicosanoyl cyanide |
| SMILES | CCCCCCCCCCCCCCCCCCCCC(=O)C#N |
| InChI | InChI=1S/C22H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(24)21-23/h2-20H2,1H3 |
| InChIKey | RLUPUIIIYHSIIL-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze henicosanoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of henicosanoyl cyanide?
The IUPAC name of henicosanoyl cyanide (CID 54273514) is henicosanoyl cyanide.
What is the SMILES notation for henicosanoyl cyanide?
The canonical SMILES for henicosanoyl cyanide is CCCCCCCCCCCCCCCCCCCCC(=O)C#N.
What is the InChIKey of henicosanoyl cyanide?
The InChIKey is RLUPUIIIYHSIIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H41NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(24)21-23/h2-20H2,1H3.
What are the key properties of henicosanoyl cyanide?
henicosanoyl cyanide has a molecular weight of 335.58 g/mol, XLogP of 7.51, 19 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for henicosanoyl cyanide is sourced from PubChem (CID 54273514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).